C9H16N2O — CID 130934600
1-(2,3-dimethylcyclobutyl)imidazolidin-2-one (PubChem CID 130934600) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclobutyl)imidazolidin-2-one.
| Compound Name | 1-(2,3-dimethylcyclobutyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 130934600 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(2,3-dimethylcyclobutyl)imidazolidin-2-one |
| SMILES | CC1CC(N2CCNC2=O)C1C |
| InChI | InChI=1S/C9H16N2O/c1-6-5-8(7(6)2)11-4-3-10-9(11)12/h6-8H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | PZBCLVIDWGGDCH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |