C9H17N3O — CID 130987498
1-(3-amino-2,2-dimethylcyclobutyl)imidazolidin-2-one (PubChem CID 130987498) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethylcyclobutyl)imidazolidin-2-one.
| Compound Name | 1-(3-amino-2,2-dimethylcyclobutyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 130987498 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(3-amino-2,2-dimethylcyclobutyl)imidazolidin-2-one |
| SMILES | CC1(C)C(N)CC1N1CCNC1=O |
| InChI | InChI=1S/C9H17N3O/c1-9(2)6(10)5-7(9)12-4-3-11-8(12)13/h6-7H,3-5,10H2,1-2H3,(H,11,13) |
| InChIKey | XMDBCFLKBLFDCY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |