C11H20N2O — CID 115371267
1-(2,2,3,3-tetramethylcyclopropyl)-1,3-diazinan-2-one (PubChem CID 115371267) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethylcyclopropyl)-1,3-diazinan-2-one.
| Compound Name | 1-(2,2,3,3-tetramethylcyclopropyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115371267 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(2,2,3,3-tetramethylcyclopropyl)-1,3-diazinan-2-one |
| SMILES | CC1(C)C(N2CCCNC2=O)C1(C)C |
| InChI | InChI=1S/C11H20N2O/c1-10(2)8(11(10,3)4)13-7-5-6-12-9(13)14/h8H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | LLJMVEKGHSWHOE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |