C7H7BrF3N3 — CID 130935208
5-bromo-N-(1,1,1-trifluoropropan-2-yl)pyrazin-2-amine (PubChem CID 130935208) has the molecular formula C7H7BrF3N3 and a molecular weight of 270.05 g/mol. Its IUPAC name is 5-bromo-N-(1,1,1-trifluoropropan-2-yl)pyrazin-2-amine.
| Compound Name | 5-bromo-N-(1,1,1-trifluoropropan-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 130935208 |
| Molecular Formula | C7H7BrF3N3 |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 5-bromo-N-(1,1,1-trifluoropropan-2-yl)pyrazin-2-amine |
| SMILES | CC(Nc1cnc(Br)cn1)C(F)(F)F |
| InChI | InChI=1S/C7H7BrF3N3/c1-4(7(9,10)11)14-6-3-12-5(8)2-13-6/h2-4H,1H3,(H,13,14) |
| InChIKey | MXCWGBAVFQMQBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |