C8H3I3S — CID 130941786
2,3,5-triiodo-1-benzothiophene (PubChem CID 130941786) has the molecular formula C8H3I3S and a molecular weight of 511.89 g/mol. Its IUPAC name is 2,3,5-triiodo-1-benzothiophene.
| Compound Name | 2,3,5-triiodo-1-benzothiophene |
|---|---|
| PubChem CID | 130941786 |
| Molecular Formula | C8H3I3S |
| Molecular Weight | 511.89 g/mol |
| Exact Mass | 511.71 |
| IUPAC Name | 2,3,5-triiodo-1-benzothiophene |
| SMILES | Ic1ccc2sc(I)c(I)c2c1 |
| InChI | InChI=1S/C8H3I3S/c9-4-1-2-6-5(3-4)7(10)8(11)12-6/h1-3H |
| InChIKey | WBKOLKXDNRYYTJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|