C11H6N2S — CID 130942345
3-methyl-1-benzothiophene-2,5-dicarbonitrile (PubChem CID 130942345) has the molecular formula C11H6N2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 3-methyl-1-benzothiophene-2,5-dicarbonitrile.
| Compound Name | 3-methyl-1-benzothiophene-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 130942345 |
| Molecular Formula | C11H6N2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 3-methyl-1-benzothiophene-2,5-dicarbonitrile |
| SMILES | Cc1c(C#N)sc2ccc(C#N)cc12 |
| InChI | InChI=1S/C11H6N2S/c1-7-9-4-8(5-12)2-3-10(9)14-11(7)6-13/h2-4H,1H3 |
| InChIKey | WQKYSDHXFSJTIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |