C10H3BrN2S — CID 131150752
3-bromo-1-benzothiophene-2,5-dicarbonitrile (PubChem CID 131150752) has the molecular formula C10H3BrN2S and a molecular weight of 263.12 g/mol. Its IUPAC name is 3-bromo-1-benzothiophene-2,5-dicarbonitrile.
| Compound Name | 3-bromo-1-benzothiophene-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 131150752 |
| Molecular Formula | C10H3BrN2S |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 261.92 |
| IUPAC Name | 3-bromo-1-benzothiophene-2,5-dicarbonitrile |
| SMILES | N#Cc1ccc2sc(C#N)c(Br)c2c1 |
| InChI | InChI=1S/C10H3BrN2S/c11-10-7-3-6(4-12)1-2-8(7)14-9(10)5-13/h1-3H |
| InChIKey | FBXBWCYWPXZYJJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |