C27H28FNO4S — CID 13094254
benzyl 4-(2-fluorophenyl)-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 13094254) has the molecular formula C27H28FNO4S and a molecular weight of 481.59 g/mol. Its IUPAC name is benzyl 4-(2-fluorophenyl)-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | benzyl 4-(2-fluorophenyl)-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 13094254 |
| Molecular Formula | C27H28FNO4S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | benzyl 4-(2-fluorophenyl)-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)OCc3ccccc3)(c3ccccc3F)C(C)C2)cc1 |
| InChI | InChI=1S/C27H28FNO4S/c1-20-12-14-23(15-13-20)34(31,32)29-17-16-27(21(2)18-29,24-10-6-7-11-25(24)28)26(30)33-19-22-8-4-3-5-9-22/h3-15,21H,16-19H2,1-2H3 |
| InChIKey | PVXOYTZZZWRUDE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |