About methyl 3-chlorosulfinylbenzoate
methyl 3-chlorosulfinylbenzoate (PubChem CID 130946697) has the molecular formula C8H7ClO3S
and a molecular weight of 218.66 g/mol. Its IUPAC name is methyl 3-chlorosulfinylbenzoate.
Molecular Properties
| Compound Name | methyl 3-chlorosulfinylbenzoate |
| PubChem CID | 130946697 |
| Molecular Formula | C8H7ClO3S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | methyl 3-chlorosulfinylbenzoate |
| SMILES | COC(=O)c1cccc(S(=O)Cl)c1 |
| InChI | InChI=1S/C8H7ClO3S/c1-12-8(10)6-3-2-4-7(5-6)13(9)11/h2-5H,1H3 |
| InChIKey | PJWLGTHDFPJDRM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-chlorosulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chlorosulfinylbenzoate?
The IUPAC name of methyl 3-chlorosulfinylbenzoate (CID 130946697) is methyl 3-chlorosulfinylbenzoate.
What is the SMILES notation for methyl 3-chlorosulfinylbenzoate?
The canonical SMILES for methyl 3-chlorosulfinylbenzoate is COC(=O)c1cccc(S(=O)Cl)c1.
What is the InChIKey of methyl 3-chlorosulfinylbenzoate?
The InChIKey is PJWLGTHDFPJDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO3S/c1-12-8(10)6-3-2-4-7(5-6)13(9)11/h2-5H,1H3.
What are the key properties of methyl 3-chlorosulfinylbenzoate?
methyl 3-chlorosulfinylbenzoate has a molecular weight of 218.66 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chlorosulfinylbenzoate is sourced from PubChem (CID 130946697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).