C22H18ClN5O2S — CID 1309478
2-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenoxyphenyl)acetamide (PubChem CID 1309478) has the molecular formula C22H18ClN5O2S and a molecular weight of 451.94 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1309478 |
| Molecular Formula | C22H18ClN5O2S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C22H18ClN5O2S/c1-15-7-10-17(13-20(15)23)28-22(25-26-27-28)31-14-21(29)24-16-8-11-19(12-9-16)30-18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H,24,29) |
| InChIKey | UWIXOHMOYPNCRF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |