C8H18N2OS — CID 130948915
1-ethylsulfinyl-6-methyl-1,4-diazepane (PubChem CID 130948915) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is 1-ethylsulfinyl-6-methyl-1,4-diazepane.
| Compound Name | 1-ethylsulfinyl-6-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 130948915 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-ethylsulfinyl-6-methyl-1,4-diazepane |
| SMILES | CCS(=O)N1CCNCC(C)C1 |
| InChI | InChI=1S/C8H18N2OS/c1-3-12(11)10-5-4-9-6-8(2)7-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | PCDJQNCMYHCAHR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |