C10H16N2O — CID 130655199
1-(6-methyl-1,4-diazepan-1-yl)but-3-yn-1-one (PubChem CID 130655199) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(6-methyl-1,4-diazepan-1-yl)but-3-yn-1-one.
| Compound Name | 1-(6-methyl-1,4-diazepan-1-yl)but-3-yn-1-one |
|---|---|
| PubChem CID | 130655199 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(6-methyl-1,4-diazepan-1-yl)but-3-yn-1-one |
| SMILES | C#CCC(=O)N1CCNCC(C)C1 |
| InChI | InChI=1S/C10H16N2O/c1-3-4-10(13)12-6-5-11-7-9(2)8-12/h1,9,11H,4-8H2,2H3 |
| InChIKey | MBKNIPXGMQVYSW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|