C9H14N2O2 — CID 130542320
1-(6-hydroxy-1,4-diazepan-1-yl)but-3-yn-1-one (PubChem CID 130542320) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(6-hydroxy-1,4-diazepan-1-yl)but-3-yn-1-one.
| Compound Name | 1-(6-hydroxy-1,4-diazepan-1-yl)but-3-yn-1-one |
|---|---|
| PubChem CID | 130542320 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(6-hydroxy-1,4-diazepan-1-yl)but-3-yn-1-one |
| SMILES | C#CCC(=O)N1CCNCC(O)C1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-9(13)11-5-4-10-6-8(12)7-11/h1,8,10,12H,3-7H2 |
| InChIKey | JNGUWHVOZAEZNG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|