C10H16BrNO — CID 130951926
N-(3-bicyclo[3.1.0]hexanyl)-2-bromo-2-methylpropanamide (PubChem CID 130951926) has the molecular formula C10H16BrNO and a molecular weight of 246.15 g/mol. Its IUPAC name is N-(3-bicyclo[3.1.0]hexanyl)-2-bromo-2-methylpropanamide.
| Compound Name | N-(3-bicyclo[3.1.0]hexanyl)-2-bromo-2-methylpropanamide |
|---|---|
| PubChem CID | 130951926 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-(3-bicyclo[3.1.0]hexanyl)-2-bromo-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)NC1CC2CC2C1 |
| InChI | InChI=1S/C10H16BrNO/c1-10(2,11)9(13)12-8-4-6-3-7(6)5-8/h6-8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | CDKBMASRVGTBNY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|