C13H22N2O — CID 90327918
N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]acetamide (PubChem CID 90327918) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]acetamide.
| Compound Name | N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]acetamide |
|---|---|
| PubChem CID | 90327918 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC2CC3CC2CC(C1)[C@H]3N |
| InChI | InChI=1S/C13H22N2O/c1-7(16)15-12-5-9-4-10-2-8(9)3-11(6-12)13(10)14/h8-13H,2-6,14H2,1H3,(H,15,16)/t8?,9?,10?,11?,12-,13+/m1/s1 |
| InChIKey | KCDFUBFCFRRVRB-DRKGDNKPSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |