C14H24N2O — CID 90327892
N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]propanamide (PubChem CID 90327892) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]propanamide.
| Compound Name | N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]propanamide |
|---|---|
| PubChem CID | 90327892 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-[(5R,11S)-11-amino-5-tricyclo[5.3.1.03,9]undecanyl]propanamide |
| SMILES | CCC(=O)N[C@@H]1CC2CC3CC2CC(C1)[C@H]3N |
| InChI | InChI=1S/C14H24N2O/c1-2-13(17)16-12-6-9-5-10-3-8(9)4-11(7-12)14(10)15/h8-12,14H,2-7,15H2,1H3,(H,16,17)/t8?,9?,10?,11?,12-,14+/m1/s1 |
| InChIKey | PMMOUQQJGATPHT-NFNGDVIGSA-N |
| XLogP | 1.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |