C11H24N2O — CID 130952021
4-(3-methyl-1,4-oxazepan-4-yl)pentan-2-amine (PubChem CID 130952021) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-(3-methyl-1,4-oxazepan-4-yl)pentan-2-amine.
| Compound Name | 4-(3-methyl-1,4-oxazepan-4-yl)pentan-2-amine |
|---|---|
| PubChem CID | 130952021 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 4-(3-methyl-1,4-oxazepan-4-yl)pentan-2-amine |
| SMILES | CC(N)CC(C)N1CCCOCC1C |
| InChI | InChI=1S/C11H24N2O/c1-9(12)7-10(2)13-5-4-6-14-8-11(13)3/h9-11H,4-8,12H2,1-3H3 |
| InChIKey | BXQYESUVNGWIRV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |