C12H14OS — CID 130955667
5-ethoxy-4,6-dimethyl-1-benzothiophene (PubChem CID 130955667) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 5-ethoxy-4,6-dimethyl-1-benzothiophene.
| Compound Name | 5-ethoxy-4,6-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 130955667 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5-ethoxy-4,6-dimethyl-1-benzothiophene |
| SMILES | CCOc1c(C)cc2sccc2c1C |
| InChI | InChI=1S/C12H14OS/c1-4-13-12-8(2)7-11-10(9(12)3)5-6-14-11/h5-7H,4H2,1-3H3 |
| InChIKey | PFVQNVULQLLQAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |