C11H15BrO — CID 143804486
1-bromo-4-ethoxy-2,3,5-trimethylbenzene (PubChem CID 143804486) has the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-bromo-4-ethoxy-2,3,5-trimethylbenzene.
| Compound Name | 1-bromo-4-ethoxy-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 143804486 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-bromo-4-ethoxy-2,3,5-trimethylbenzene |
| SMILES | CCOc1c(C)cc(Br)c(C)c1C |
| InChI | InChI=1S/C11H15BrO/c1-5-13-11-7(2)6-10(12)8(3)9(11)4/h6H,5H2,1-4H3 |
| InChIKey | KWWFIHQWXJHYOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |