About 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde
2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde (PubChem CID 130957357) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde |
| PubChem CID | 130957357 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde |
| SMILES | C[C@@H](O)[C@](N)(O)c1ccccc1C=O |
| InChI | InChI=1S/C10H13NO3/c1-7(13)10(11,14)9-5-3-2-4-8(9)6-12/h2-7,13-14H,11H2,1H3/t7-,10+/m1/s1 |
| InChIKey | FNDFXPBGUFBRGX-XCBNKYQSSA-N |
| XLogP | -0.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde?
The IUPAC name of 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde (CID 130957357) is 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde.
What is the SMILES notation for 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde?
The canonical SMILES for 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde is C[C@@H](O)[C@](N)(O)c1ccccc1C=O.
What is the InChIKey of 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde?
The InChIKey is FNDFXPBGUFBRGX-XCBNKYQSSA-N. The full InChI is InChI=1S/C10H13NO3/c1-7(13)10(11,14)9-5-3-2-4-8(9)6-12/h2-7,13-14H,11H2,1H3/t7-,10+/m1/s1.
What are the key properties of 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde?
2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde has a molecular weight of 195.22 g/mol, XLogP of -0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-1-amino-1,2-dihydroxypropyl]benzaldehyde is sourced from PubChem (CID 130957357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).