C10H11NO5 — CID 171869377
3-(2-formylphenyl)-2,3,3-trihydroxypropanamide (PubChem CID 171869377) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 3-(2-formylphenyl)-2,3,3-trihydroxypropanamide.
| Compound Name | 3-(2-formylphenyl)-2,3,3-trihydroxypropanamide |
|---|---|
| PubChem CID | 171869377 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(2-formylphenyl)-2,3,3-trihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)(O)c1ccccc1C=O |
| InChI | InChI=1S/C10H11NO5/c11-9(14)8(13)10(15,16)7-4-2-1-3-6(7)5-12/h1-5,8,13,15-16H,(H2,11,14) |
| InChIKey | XFLPOQYJOXJPLB-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|