C8H13NO3 — CID 130961806
(6R,7S,8S)-6,7-dihydroxy-7-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 130961806) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (6R,7S,8S)-6,7-dihydroxy-7-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (6R,7S,8S)-6,7-dihydroxy-7-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 130961806 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (6R,7S,8S)-6,7-dihydroxy-7-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@]1(O)[C@H](O)CN2C(=O)CC[C@H]21 |
| InChI | InChI=1S/C8H13NO3/c1-8(12)5-2-3-7(11)9(5)4-6(8)10/h5-6,10,12H,2-4H2,1H3/t5-,6+,8-/m0/s1 |
| InChIKey | MBBJYCCLKLLIOZ-BBVRLYRLSA-N |
| XLogP | -0.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |