C9H14N2O2 — CID 130964727
5-ethyl-N,N,3-trimethyl-1,2-oxazole-4-carboxamide (PubChem CID 130964727) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-ethyl-N,N,3-trimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-ethyl-N,N,3-trimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 130964727 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5-ethyl-N,N,3-trimethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1onc(C)c1C(=O)N(C)C |
| InChI | InChI=1S/C9H14N2O2/c1-5-7-8(6(2)10-13-7)9(12)11(3)4/h5H2,1-4H3 |
| InChIKey | OIIUCRIGARNGGP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |