About trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid
trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid (PubChem CID 130964910) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid.
Analyze trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid?
The IUPAC name of trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid (CID 130964910) is trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid.
What is the SMILES notation for trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid?
The canonical SMILES for trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid is CC1(C)C[C@@H](C(=O)O)C[C@H]1C(=O)O.
What is the InChIKey of trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid?
The InChIKey is RJHVOZJTTQJEDR-WDSKDSINSA-N. The full InChI is InChI=1S/C9H14O4/c1-9(2)4-5(7(10)11)3-6(9)8(12)13/h5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1.
What are the key properties of trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid?
trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid has a molecular weight of 186.21 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3R)-4,4-dimethylcyclopentane-1,3-dicarboxylic acid is sourced from PubChem (CID 130964910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).