4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid

C12H22O3 — CID 118941567

IUPAC4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid
SMILESCOC1C(C)(C)CC(C(=O)O)CC1(C)C
InChIInChI=1S/C12H22O3/c1-11(2)6-8(9(13)14)7-12(3,4)10(11)15-5/h8,10H,6-7H2,1-5H3,(H,13,14)
InChIKeyNVYVZVHJQUFNOT-UHFFFAOYSA-N
MW214.30 g/mol
LogP2.55
Rot. Bonds2

About 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid

4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid (PubChem CID 118941567) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid
PubChem CID118941567
Molecular FormulaC12H22O3
Molecular Weight214.30 g/mol
Exact Mass214.16
IUPAC Name4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid
SMILESCOC1C(C)(C)CC(C(=O)O)CC1(C)C
InChIInChI=1S/C12H22O3/c1-11(2)6-8(9(13)14)7-12(3,4)10(11)15-5/h8,10H,6-7H2,1-5H3,(H,13,14)
InChIKeyNVYVZVHJQUFNOT-UHFFFAOYSA-N
XLogP2.55
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.30
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid?
The IUPAC name of 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid (CID 118941567) is 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid?
The canonical SMILES for 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid is COC1C(C)(C)CC(C(=O)O)CC1(C)C.
What is the InChIKey of 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid?
The InChIKey is NVYVZVHJQUFNOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-11(2)6-8(9(13)14)7-12(3,4)10(11)15-5/h8,10H,6-7H2,1-5H3,(H,13,14).
What are the key properties of 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid?
4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid has a molecular weight of 214.30 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 118941567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).