C19H34O — CID 59950968
bis(3,3,4-trimethylcyclohexyl)methanone (PubChem CID 59950968) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is bis(3,3,4-trimethylcyclohexyl)methanone.
| Compound Name | bis(3,3,4-trimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 59950968 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | bis(3,3,4-trimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)C2CCC(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C19H34O/c1-13-7-9-15(11-18(13,3)4)17(20)16-10-8-14(2)19(5,6)12-16/h13-16H,7-12H2,1-6H3 |
| InChIKey | ZLNKOZUTARLCLC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |