C12H18F2O — CID 118883086
(3,3-difluorocyclobutyl)-(4-methylcyclohexyl)methanone (PubChem CID 118883086) has the molecular formula C12H18F2O and a molecular weight of 216.27 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-(4-methylcyclohexyl)methanone.
| Compound Name | (3,3-difluorocyclobutyl)-(4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 118883086 |
| Molecular Formula | C12H18F2O |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3,3-difluorocyclobutyl)-(4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)C2CC(F)(F)C2)CC1 |
| InChI | InChI=1S/C12H18F2O/c1-8-2-4-9(5-3-8)11(15)10-6-12(13,14)7-10/h8-10H,2-7H2,1H3 |
| InChIKey | PVZJNPGNGJLQAG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |