C9H8O2S2 — CID 130969427
3-methylsulfanyl-1-benzothiophene-4,7-diol (PubChem CID 130969427) has the molecular formula C9H8O2S2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-methylsulfanyl-1-benzothiophene-4,7-diol.
| Compound Name | 3-methylsulfanyl-1-benzothiophene-4,7-diol |
|---|---|
| PubChem CID | 130969427 |
| Molecular Formula | C9H8O2S2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 3-methylsulfanyl-1-benzothiophene-4,7-diol |
| SMILES | CSc1csc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C9H8O2S2/c1-12-7-4-13-9-6(11)3-2-5(10)8(7)9/h2-4,10-11H,1H3 |
| InChIKey | FXXZDELVLKIUEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|