C10H15NO2 — CID 130978574
(5S,7S,8aR)-5-ethenyl-7-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 130978574) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (5S,7S,8aR)-5-ethenyl-7-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5S,7S,8aR)-5-ethenyl-7-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 130978574 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (5S,7S,8aR)-5-ethenyl-7-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C=C[C@@H]1C[C@@H](O)C[C@H]2CCC(=O)N21 |
| InChI | InChI=1S/C10H15NO2/c1-2-7-5-9(12)6-8-3-4-10(13)11(7)8/h2,7-9,12H,1,3-6H2/t7-,8-,9-/m1/s1 |
| InChIKey | RJJUVJYYFLNEGJ-IWSPIJDZSA-N |
| XLogP | 0.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|