C10H15NO3 — CID 130979256
2-methyl-1-prop-2-enoylpiperidine-3-carboxylic acid (PubChem CID 130979256) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enoylpiperidine-3-carboxylic acid.
| Compound Name | 2-methyl-1-prop-2-enoylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130979256 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-methyl-1-prop-2-enoylpiperidine-3-carboxylic acid |
| SMILES | C=CC(=O)N1CCCC(C(=O)O)C1C |
| InChI | InChI=1S/C10H15NO3/c1-3-9(12)11-6-4-5-8(7(11)2)10(13)14/h3,7-8H,1,4-6H2,2H3,(H,13,14) |
| InChIKey | XTNARUKUWOZFTE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|