C8H14N2O3 — CID 130961604
1-carbamoyl-2-methylpiperidine-3-carboxylic acid (PubChem CID 130961604) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-carbamoyl-2-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-carbamoyl-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130961604 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-carbamoyl-2-methylpiperidine-3-carboxylic acid |
| SMILES | CC1C(C(=O)O)CCCN1C(N)=O |
| InChI | InChI=1S/C8H14N2O3/c1-5-6(7(11)12)3-2-4-10(5)8(9)13/h5-6H,2-4H2,1H3,(H2,9,13)(H,11,12) |
| InChIKey | GAQLZOQBWMCHHG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |