C8H13N3OS2 — CID 130986014
5-[(3-methyloxolan-3-yl)methylamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 130986014) has the molecular formula C8H13N3OS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 5-[(3-methyloxolan-3-yl)methylamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(3-methyloxolan-3-yl)methylamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 130986014 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 5-[(3-methyloxolan-3-yl)methylamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC1(CNc2n[nH]c(=S)s2)CCOC1 |
| InChI | InChI=1S/C8H13N3OS2/c1-8(2-3-12-5-8)4-9-6-10-11-7(13)14-6/h2-5H2,1H3,(H,9,10)(H,11,13) |
| InChIKey | YUAFWZPFFCWFEO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|