C6H9N3OS2 — CID 80713304
5-(oxolan-3-ylamino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 80713304) has the molecular formula C6H9N3OS2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 5-(oxolan-3-ylamino)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(oxolan-3-ylamino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 80713304 |
| Molecular Formula | C6H9N3OS2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 5-(oxolan-3-ylamino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(NC2CCOC2)s1 |
| InChI | InChI=1S/C6H9N3OS2/c11-6-9-8-5(12-6)7-4-1-2-10-3-4/h4H,1-3H2,(H,7,8)(H,9,11) |
| InChIKey | JYRMJIGFPWWKNK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|