C8H11ClN2O2S — CID 130735722
[4-chloro-2-(oxolan-3-ylamino)-1,3-thiazol-5-yl]methanol (PubChem CID 130735722) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is [4-chloro-2-(oxolan-3-ylamino)-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-chloro-2-(oxolan-3-ylamino)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 130735722 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | [4-chloro-2-(oxolan-3-ylamino)-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1sc(NC2CCOC2)nc1Cl |
| InChI | InChI=1S/C8H11ClN2O2S/c9-7-6(3-12)14-8(11-7)10-5-1-2-13-4-5/h5,12H,1-4H2,(H,10,11) |
| InChIKey | LNNDGQDSZBUADW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |