C8H12N4OS — CID 130986202
5-(1,2,5-thiadiazol-3-ylmethylamino)piperidin-2-one (PubChem CID 130986202) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 5-(1,2,5-thiadiazol-3-ylmethylamino)piperidin-2-one.
| Compound Name | 5-(1,2,5-thiadiazol-3-ylmethylamino)piperidin-2-one |
|---|---|
| PubChem CID | 130986202 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 5-(1,2,5-thiadiazol-3-ylmethylamino)piperidin-2-one |
| SMILES | O=C1CCC(NCc2cnsn2)CN1 |
| InChI | InChI=1S/C8H12N4OS/c13-8-2-1-6(3-10-8)9-4-7-5-11-14-12-7/h5-6,9H,1-4H2,(H,10,13) |
| InChIKey | BMUHLFAZWIENPE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |