C9H5BrN2OS — CID 130988850
(5-bromo-2-pyridinyl)-(1,2-thiazol-5-yl)methanone (PubChem CID 130988850) has the molecular formula C9H5BrN2OS and a molecular weight of 269.12 g/mol. Its IUPAC name is (5-bromo-2-pyridinyl)-(1,2-thiazol-5-yl)methanone.
| Compound Name | (5-bromo-2-pyridinyl)-(1,2-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 130988850 |
| Molecular Formula | C9H5BrN2OS |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 267.93 |
| IUPAC Name | (5-bromo-2-pyridinyl)-(1,2-thiazol-5-yl)methanone |
| SMILES | O=C(c1ccc(Br)cn1)c1ccns1 |
| InChI | InChI=1S/C9H5BrN2OS/c10-6-1-2-7(11-5-6)9(13)8-3-4-12-14-8/h1-5H |
| InChIKey | AULCKCARAWOSIP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |