C9H6BrNO4 — CID 151174213
4-(5-bromo-2-pyridinyl)-2,4-dioxobutanoic acid (PubChem CID 151174213) has the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. Its IUPAC name is 4-(5-bromo-2-pyridinyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(5-bromo-2-pyridinyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 151174213 |
| Molecular Formula | C9H6BrNO4 |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 4-(5-bromo-2-pyridinyl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C9H6BrNO4/c10-5-1-2-6(11-4-5)7(12)3-8(13)9(14)15/h1-2,4H,3H2,(H,14,15) |
| InChIKey | NCXNCPJKISHBMK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|