C8H7BrClN3O2 — CID 58997432
5-bromo-N'-(2-chloroacetyl)pyridine-2-carbohydrazide (PubChem CID 58997432) has the molecular formula C8H7BrClN3O2 and a molecular weight of 292.52 g/mol. Its IUPAC name is 5-bromo-N'-(2-chloroacetyl)pyridine-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(2-chloroacetyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58997432 |
| Molecular Formula | C8H7BrClN3O2 |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | 5-bromo-N'-(2-chloroacetyl)pyridine-2-carbohydrazide |
| SMILES | O=C(CCl)NNC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C8H7BrClN3O2/c9-5-1-2-6(11-4-5)8(15)13-12-7(14)3-10/h1-2,4H,3H2,(H,12,14)(H,13,15) |
| InChIKey | SMNMRQMMMGXHQB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|