About 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide
4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 12921227) has the molecular formula C6H6BrClN4O2
and a molecular weight of 281.50 g/mol. Its IUPAC name is 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide.
Molecular Properties
| Compound Name | 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide |
| PubChem CID | 12921227 |
| Molecular Formula | C6H6BrClN4O2 |
| Molecular Weight | 281.50 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CCl)NNC(=O)c1[nH]ncc1Br |
| InChI | InChI=1S/C6H6BrClN4O2/c7-3-2-9-11-5(3)6(14)12-10-4(13)1-8/h2H,1H2,(H,9,11)(H,10,13)(H,12,14) |
| InChIKey | LHEKOKGWOAUQAK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.50 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide?
The IUPAC name of 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide (CID 12921227) is 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide.
What is the SMILES notation for 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide?
The canonical SMILES for 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide is O=C(CCl)NNC(=O)c1[nH]ncc1Br.
What is the InChIKey of 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide?
The InChIKey is LHEKOKGWOAUQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrClN4O2/c7-3-2-9-11-5(3)6(14)12-10-4(13)1-8/h2H,1H2,(H,9,11)(H,10,13)(H,12,14).
What are the key properties of 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide?
4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide has a molecular weight of 281.50 g/mol, XLogP of 0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N'-(2-chloroacetyl)-1H-pyrazole-5-carbohydrazide is sourced from PubChem (CID 12921227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).