C8H12BrN3O — CID 39854761
4-bromo-N,N-diethyl-1H-pyrazole-5-carboxamide (PubChem CID 39854761) has the molecular formula C8H12BrN3O and a molecular weight of 246.11 g/mol. Its IUPAC name is 4-bromo-N,N-diethyl-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N,N-diethyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39854761 |
| Molecular Formula | C8H12BrN3O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 4-bromo-N,N-diethyl-1H-pyrazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1[nH]ncc1Br |
| InChI | InChI=1S/C8H12BrN3O/c1-3-12(4-2)8(13)7-6(9)5-10-11-7/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | DZNSGRXXILEMHH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |