C12H14O2 — CID 130989698
cis-(2R,6S)-2-hydroxy-6-phenylcyclohexan-1-one (PubChem CID 130989698) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is cis-(2R,6S)-2-hydroxy-6-phenylcyclohexan-1-one.
| Compound Name | cis-(2R,6S)-2-hydroxy-6-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 130989698 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | cis-(2R,6S)-2-hydroxy-6-phenylcyclohexan-1-one |
| SMILES | O=C1[C@H](O)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-3,5-6,10-11,13H,4,7-8H2/t10-,11+/m0/s1 |
| InChIKey | LXDNIPPYFYGNEF-WDEREUQCSA-N |
| XLogP | 1.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |