C16H20O3 — CID 11448344
(2R,4R,6R)-4-hydroxy-2-methoxy-6-(1-phenylprop-2-enyl)cyclohexan-1-one (PubChem CID 11448344) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,4R,6R)-4-hydroxy-2-methoxy-6-(1-phenylprop-2-enyl)cyclohexan-1-one.
| Compound Name | (2R,4R,6R)-4-hydroxy-2-methoxy-6-(1-phenylprop-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11448344 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R,4R,6R)-4-hydroxy-2-methoxy-6-(1-phenylprop-2-enyl)cyclohexan-1-one |
| SMILES | C=CC(c1ccccc1)[C@H]1C[C@@H](O)C[C@@H](OC)C1=O |
| InChI | InChI=1S/C16H20O3/c1-3-13(11-7-5-4-6-8-11)14-9-12(17)10-15(19-2)16(14)18/h3-8,12-15,17H,1,9-10H2,2H3/t12-,13?,14-,15-/m1/s1 |
| InChIKey | YIXVBISJCATYND-RNLVXLIHSA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|