About 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate
1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate (PubChem CID 68786190) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate |
| PubChem CID | 68786190 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate |
| SMILES | C=CC(OC(=O)C1CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c1-2-14(12-8-4-3-5-9-12)17-15(16)13-10-6-7-11-13/h2-9,13-14H,1,10-11H2 |
| InChIKey | LPXHDIXAOHBMEO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate?
The IUPAC name of 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate (CID 68786190) is 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate.
What is the SMILES notation for 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate?
The canonical SMILES for 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate is C=CC(OC(=O)C1CC=CC1)c1ccccc1.
What is the InChIKey of 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate?
The InChIKey is LPXHDIXAOHBMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-2-14(12-8-4-3-5-9-12)17-15(16)13-10-6-7-11-13/h2-9,13-14H,1,10-11H2.
What are the key properties of 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate?
1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylprop-2-enyl cyclopent-3-ene-1-carboxylate is sourced from PubChem (CID 68786190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).