About benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate
benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate (PubChem CID 87327992) has the molecular formula C23H20O2S2
and a molecular weight of 392.55 g/mol. Its IUPAC name is benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate |
| PubChem CID | 87327992 |
| Molecular Formula | C23H20O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate |
| SMILES | C=CC(OC(=S)c1ccccc1)c1ccccc1.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C16H14OS.C7H6OS/c1-2-15(13-9-5-3-6-10-13)17-16(18)14-11-7-4-8-12-14;8-7(9)6-4-2-1-3-5-6/h2-12,15H,1H2;1-5H,(H,8,9) |
| InChIKey | HUDQVAFYPKCEBF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate?
The IUPAC name of benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate (CID 87327992) is benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate.
What is the SMILES notation for benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate?
The canonical SMILES for benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate is C=CC(OC(=S)c1ccccc1)c1ccccc1.O=C(S)c1ccccc1.
What is the InChIKey of benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate?
The InChIKey is HUDQVAFYPKCEBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS.C7H6OS/c1-2-15(13-9-5-3-6-10-13)17-16(18)14-11-7-4-8-12-14;8-7(9)6-4-2-1-3-5-6/h2-12,15H,1H2;1-5H,(H,8,9).
What are the key properties of benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate?
benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate has a molecular weight of 392.55 g/mol, XLogP of 6.06, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;O-(1-phenylprop-2-enyl) benzenecarbothioate is sourced from PubChem (CID 87327992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).