About benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane
benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane (PubChem CID 175153529) has the molecular formula C18H19NO2S2
and a molecular weight of 345.49 g/mol. Its IUPAC name is benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane |
| PubChem CID | 175153529 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane |
| SMILES | CCC.N#COC(=S)c1ccccc1.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C8H5NOS.C7H6OS.C3H8/c9-6-10-8(11)7-4-2-1-3-5-7;8-7(9)6-4-2-1-3-5-6;1-3-2/h1-5H;1-5H,(H,8,9);3H2,1-2H3 |
| InChIKey | SHXQKZPGWZWOEB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane?
The IUPAC name of benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane (CID 175153529) is benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane.
What is the SMILES notation for benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane?
The canonical SMILES for benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane is CCC.N#COC(=S)c1ccccc1.O=C(S)c1ccccc1.
What is the InChIKey of benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane?
The InChIKey is SHXQKZPGWZWOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS.C7H6OS.C3H8/c9-6-10-8(11)7-4-2-1-3-5-7;8-7(9)6-4-2-1-3-5-6;1-3-2/h1-5H;1-5H,(H,8,9);3H2,1-2H3.
What are the key properties of benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane?
benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane has a molecular weight of 345.49 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;O-cyano benzenecarbothioate;propane is sourced from PubChem (CID 175153529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).