About benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate
benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate (PubChem CID 87518961) has the molecular formula C19H20O4S2
and a molecular weight of 376.50 g/mol. Its IUPAC name is benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate |
| PubChem CID | 87518961 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)OC(=S)c1ccccc1.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C12H14O3S.C7H6OS/c1-12(2,11(13)14-3)15-10(16)9-7-5-4-6-8-9;8-7(9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,(H,8,9) |
| InChIKey | IYCLSTTUFKMYIT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate?
The IUPAC name of benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate (CID 87518961) is benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate.
What is the SMILES notation for benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate?
The canonical SMILES for benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate is COC(=O)C(C)(C)OC(=S)c1ccccc1.O=C(S)c1ccccc1.
What is the InChIKey of benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate?
The InChIKey is IYCLSTTUFKMYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3S.C7H6OS/c1-12(2,11(13)14-3)15-10(16)9-7-5-4-6-8-9;8-7(9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,(H,8,9).
What are the key properties of benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate?
benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate has a molecular weight of 376.50 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;methyl 2-(benzenecarbonothioyloxy)-2-methylpropanoate is sourced from PubChem (CID 87518961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).