About O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate
O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate (PubChem CID 175129518) has the molecular formula C19H19NO2S2
and a molecular weight of 357.50 g/mol. Its IUPAC name is O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate.
Molecular Properties
| Compound Name | O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate |
| PubChem CID | 175129518 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate |
| SMILES | CC(C)COC(=S)c1ccccc1.N#COC(=S)c1ccccc1 |
| InChI | InChI=1S/C11H14OS.C8H5NOS/c1-9(2)8-12-11(13)10-6-4-3-5-7-10;9-6-10-8(11)7-4-2-1-3-5-7/h3-7,9H,8H2,1-2H3;1-5H |
| InChIKey | FFVADFSMRSRILI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate?
The IUPAC name of O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate (CID 175129518) is O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate.
What is the SMILES notation for O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate?
The canonical SMILES for O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate is CC(C)COC(=S)c1ccccc1.N#COC(=S)c1ccccc1.
What is the InChIKey of O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate?
The InChIKey is FFVADFSMRSRILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS.C8H5NOS/c1-9(2)8-12-11(13)10-6-4-3-5-7-10;9-6-10-8(11)7-4-2-1-3-5-7/h3-7,9H,8H2,1-2H3;1-5H.
What are the key properties of O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate?
O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate has a molecular weight of 357.50 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-cyano benzenecarbothioate;O-(2-methylpropyl) benzenecarbothioate is sourced from PubChem (CID 175129518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).