C15H18OS — CID 14200675
2-(1-phenylprop-2-enyl)thiepan-3-one (PubChem CID 14200675) has the molecular formula C15H18OS and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-(1-phenylprop-2-enyl)thiepan-3-one.
| Compound Name | 2-(1-phenylprop-2-enyl)thiepan-3-one |
|---|---|
| PubChem CID | 14200675 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-(1-phenylprop-2-enyl)thiepan-3-one |
| SMILES | C=CC(c1ccccc1)C1SCCCCC1=O |
| InChI | InChI=1S/C15H18OS/c1-2-13(12-8-4-3-5-9-12)15-14(16)10-6-7-11-17-15/h2-5,8-9,13,15H,1,6-7,10-11H2 |
| InChIKey | VHWUEIAZNICGNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|