C18H22O2S — CID 102421374
2-(2,2-dimethylpropanoyl)-2-(1-phenylprop-2-enyl)thiolan-3-one (PubChem CID 102421374) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyl)-2-(1-phenylprop-2-enyl)thiolan-3-one.
| Compound Name | 2-(2,2-dimethylpropanoyl)-2-(1-phenylprop-2-enyl)thiolan-3-one |
|---|---|
| PubChem CID | 102421374 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(2,2-dimethylpropanoyl)-2-(1-phenylprop-2-enyl)thiolan-3-one |
| SMILES | C=CC(c1ccccc1)C1(C(=O)C(C)(C)C)SCCC1=O |
| InChI | InChI=1S/C18H22O2S/c1-5-14(13-9-7-6-8-10-13)18(15(19)11-12-21-18)16(20)17(2,3)4/h5-10,14H,1,11-12H2,2-4H3 |
| InChIKey | MOPCNUOLSFZMRC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|