C20H18OS — CID 177419162
(2E)-2-[3-(1-phenylprop-2-enyl)-2,3-dihydrothiochromen-4-ylidene]acetaldehyde (PubChem CID 177419162) has the molecular formula C20H18OS and a molecular weight of 306.43 g/mol. Its IUPAC name is (2E)-2-[3-(1-phenylprop-2-enyl)-2,3-dihydrothiochromen-4-ylidene]acetaldehyde.
| Compound Name | (2E)-2-[3-(1-phenylprop-2-enyl)-2,3-dihydrothiochromen-4-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 177419162 |
| Molecular Formula | C20H18OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2E)-2-[3-(1-phenylprop-2-enyl)-2,3-dihydrothiochromen-4-ylidene]acetaldehyde |
| SMILES | C=CC(c1ccccc1)C1CSc2ccccc2/C1=C/C=O |
| InChI | InChI=1S/C20H18OS/c1-2-16(15-8-4-3-5-9-15)19-14-22-20-11-7-6-10-18(20)17(19)12-13-21/h2-13,16,19H,1,14H2/b17-12- |
| InChIKey | GYJAYUMJNBRCDE-ATVHPVEESA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|